About [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate
[3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate (PubChem CID 74329007) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate |
| PubChem CID | 74329007 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate |
| SMILES | CC(=CCOC(=O)CC(C)C)CCC=C(C)COC(=O)CC(C)C |
| InChI | InChI=1S/C20H34O4/c1-15(2)12-19(21)23-11-10-17(5)8-7-9-18(6)14-24-20(22)13-16(3)4/h9-10,15-16H,7-8,11-14H2,1-6H3 |
| InChIKey | JEJKMYCLMRJPPT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate?
The IUPAC name of [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate (CID 74329007) is [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate.
What is the SMILES notation for [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate?
The canonical SMILES for [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate is CC(=CCOC(=O)CC(C)C)CCC=C(C)COC(=O)CC(C)C.
What is the InChIKey of [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate?
The InChIKey is JEJKMYCLMRJPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O4/c1-15(2)12-19(21)23-11-10-17(5)8-7-9-18(6)14-24-20(22)13-16(3)4/h9-10,15-16H,7-8,11-14H2,1-6H3.
What are the key properties of [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate?
[3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate has a molecular weight of 338.49 g/mol, XLogP of 4.84, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,7-dimethyl-8-(3-methylbutanoyloxy)octa-2,6-dienyl] 3-methylbutanoate is sourced from PubChem (CID 74329007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).