About 3,5-dinitrobenzoic acid
3,5-dinitrobenzoic acid (PubChem CID 7433) has the molecular formula C7H4N2O6
and a molecular weight of 212.12 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid.
Molecular Properties
| Compound Name | 3,5-dinitrobenzoic acid |
| PubChem CID | 7433 |
| Molecular Formula | C7H4N2O6 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 3,5-dinitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11) |
| InChIKey | VYWYYJYRVSBHJQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitrobenzoic acid?
The IUPAC name of 3,5-dinitrobenzoic acid (CID 7433) is 3,5-dinitrobenzoic acid.
What is the SMILES notation for 3,5-dinitrobenzoic acid?
The canonical SMILES for 3,5-dinitrobenzoic acid is O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of 3,5-dinitrobenzoic acid?
The InChIKey is VYWYYJYRVSBHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11).
What are the key properties of 3,5-dinitrobenzoic acid?
3,5-dinitrobenzoic acid has a molecular weight of 212.12 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitrobenzoic acid is sourced from PubChem (CID 7433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).