C21H27N3O4 — CID 74330315
3-(1,3-benzodioxol-5-yl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]but-2-en-1-one (PubChem CID 74330315) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]but-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 74330315 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]but-2-en-1-one |
| SMILES | CC(=CC(=O)N1CCN(CC(=O)N2CCCC2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H27N3O4/c1-16(17-4-5-18-19(13-17)28-15-27-18)12-20(25)24-10-8-22(9-11-24)14-21(26)23-6-2-3-7-23/h4-5,12-13H,2-3,6-11,14-15H2,1H3 |
| InChIKey | QSPLXNMCBUHRBL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|