C30H54O5 — CID 74332597
2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-1,2,3,22,23-pentol (PubChem CID 74332597) has the molecular formula C30H54O5 and a molecular weight of 494.76 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-1,2,3,22,23-pentol.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-1,2,3,22,23-pentol |
|---|---|
| PubChem CID | 74332597 |
| Molecular Formula | C30H54O5 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraene-1,2,3,22,23-pentol |
| SMILES | CC(=CCCC=C(C)CCC=C(C)CCC(O)C(C)(O)CO)CCC=C(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C30H54O5/c1-23(14-10-16-25(3)18-20-27(32)29(5,6)34)12-8-9-13-24(2)15-11-17-26(4)19-21-28(33)30(7,35)22-31/h12-13,16-17,27-28,31-35H,8-11,14-15,18-22H2,1-7H3 |
| InChIKey | WRTOUBQZZGFLLV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|