C10H14O5 — CID 74333830
10-hydroxy-6-methyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one (PubChem CID 74333830) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 10-hydroxy-6-methyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one.
| Compound Name | 10-hydroxy-6-methyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one |
|---|---|
| PubChem CID | 74333830 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 10-hydroxy-6-methyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one |
| SMILES | CC1CC2OC2C2OC2C(O)CC(=O)O1 |
| InChI | InChI=1S/C10H14O5/c1-4-2-6-9(14-6)10-8(15-10)5(11)3-7(12)13-4/h4-6,8-11H,2-3H2,1H3 |
| InChIKey | BVFFUSVHPGHUFQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|