About 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide
2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide (PubChem CID 7433470) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide |
| PubChem CID | 7433470 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C20H18N4O2/c1-14-20(15(2)24(23-14)17-9-4-3-5-10-17)22-19(25)13-26-18-11-7-6-8-16(18)12-21/h3-11H,13H2,1-2H3,(H,22,25) |
| InChIKey | ZHRSPSBMLLQKMW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide?
The IUPAC name of 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide (CID 7433470) is 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide.
What is the SMILES notation for 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide?
The canonical SMILES for 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide is Cc1nn(-c2ccccc2)c(C)c1NC(=O)COc1ccccc1C#N.
What is the InChIKey of 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide?
The InChIKey is ZHRSPSBMLLQKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-14-20(15(2)24(23-14)17-9-4-3-5-10-17)22-19(25)13-26-18-11-7-6-8-16(18)12-21/h3-11H,13H2,1-2H3,(H,22,25).
What are the key properties of 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide?
2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide has a molecular weight of 346.39 g/mol, XLogP of 3.38, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanophenoxy)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide is sourced from PubChem (CID 7433470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).