C29H33NO7 — CID 74335166
2-methoxy-3-(nitromethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 74335166) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is 2-methoxy-3-(nitromethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | 2-methoxy-3-(nitromethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 74335166 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-methoxy-3-(nitromethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1C[N+](=O)[O-] |
| InChI | InChI=1S/C29H33NO7/c1-33-29-25(17-30(31)32)27(35-19-23-13-7-3-8-14-23)28(36-20-24-15-9-4-10-16-24)26(37-29)21-34-18-22-11-5-2-6-12-22/h2-16,25-29H,17-21H2,1H3 |
| InChIKey | XVBOVJAMIDNSAF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|