C19H15N5 — CID 743357
16-(2-methylimidazol-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 743357) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 16-(2-methylimidazol-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-(2-methylimidazol-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 743357 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 16-(2-methylimidazol-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | Cc1nccn1-c1c2c(c(C#N)c3nc4ccccc4n13)CCC2 |
| InChI | InChI=1S/C19H15N5/c1-12-21-9-10-23(12)19-14-6-4-5-13(14)15(11-20)18-22-16-7-2-3-8-17(16)24(18)19/h2-3,7-10H,4-6H2,1H3 |
| InChIKey | GCADTYLJGLGURF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |