C21H20O10 — CID 74336038
6,7-dihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one (PubChem CID 74336038) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is 6,7-dihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one.
| Compound Name | 6,7-dihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 74336038 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 6,7-dihydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| SMILES | O=c1c(C2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)15-16(26)10-5-11(24)12(25)6-13(10)30-20(15)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2 |
| InChIKey | CJSASESAYLKYSJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 181.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|