C30H38O10 — CID 74336539
(11-acetyloxy-3-hydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 2-methylbut-2-enoate (PubChem CID 74336539) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is (11-acetyloxy-3-hydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 2-methylbut-2-enoate.
| Compound Name | (11-acetyloxy-3-hydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 74336539 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (11-acetyloxy-3-hydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1c2cc(OC)c(OC)c(O)c2-c2c(cc(OC)c(OC)c2OC)C(OC(C)=O)C(C)C1C |
| InChI | InChI=1S/C30H38O10/c1-11-14(2)30(33)40-26-16(4)15(3)25(39-17(5)31)19-13-21(35-7)28(37-9)29(38-10)23(19)22-18(26)12-20(34-6)27(36-8)24(22)32/h11-13,15-16,25-26,32H,1-10H3 |
| InChIKey | MLZWZUMLLVUXMT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|