About 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one
7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one (PubChem CID 74337732) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one.
Molecular Properties
| Compound Name | 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one |
| PubChem CID | 74337732 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one |
| SMILES | CCCC1CC2OC2C=CC(O)CC(=O)O1 |
| InChI | InChI=1S/C12H18O4/c1-2-3-9-7-11-10(16-11)5-4-8(13)6-12(14)15-9/h4-5,8-11,13H,2-3,6-7H2,1H3 |
| InChIKey | VHLQBMDWATUSGI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one?
The IUPAC name of 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one (CID 74337732) is 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one.
What is the SMILES notation for 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one?
The canonical SMILES for 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one is CCCC1CC2OC2C=CC(O)CC(=O)O1.
What is the InChIKey of 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one?
The InChIKey is VHLQBMDWATUSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-3-9-7-11-10(16-11)5-4-8(13)6-12(14)15-9/h4-5,8-11,13H,2-3,6-7H2,1H3.
What are the key properties of 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one?
7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one has a molecular weight of 226.27 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3-propyl-4,11-dioxabicyclo[8.1.0]undec-8-en-5-one is sourced from PubChem (CID 74337732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).