C24H23Cl2N3O4 — CID 74338092
2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoic acid (PubChem CID 74338092) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 74338092 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1cccc(OCCCNc2ccccn2)c1)C(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O4/c25-18-8-4-9-19(26)22(18)23(30)29-20(24(31)32)15-16-6-3-7-17(14-16)33-13-5-12-28-21-10-1-2-11-27-21/h1-4,6-11,14,20H,5,12-13,15H2,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | KRNPACMXJWBKFZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|