About [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate
[2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7433921) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate |
| PubChem CID | 7433921 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(=O)COC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-19(2,3)18(24)21-14-9-7-13(8-10-14)16(22)12-25-17(23)15-6-4-5-11-20-15/h4-11H,12H2,1-3H3,(H,21,24) |
| InChIKey | ZRUOZHCMUCYHRM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate?
The IUPAC name of [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate (CID 7433921) is [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate.
What is the SMILES notation for [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate?
The canonical SMILES for [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate is CC(C)(C)C(=O)Nc1ccc(C(=O)COC(=O)c2ccccn2)cc1.
What is the InChIKey of [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate?
The InChIKey is ZRUOZHCMUCYHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-19(2,3)18(24)21-14-9-7-13(8-10-14)16(22)12-25-17(23)15-6-4-5-11-20-15/h4-11H,12H2,1-3H3,(H,21,24).
What are the key properties of [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate?
[2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate has a molecular weight of 340.38 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate is sourced from PubChem (CID 7433921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).