C27H22O4 — CID 74340057
13-butyl-12,25-dioxahexacyclo[11.11.1.02,11.04,9.015,24.016,21]pentacosa-2(11),4,6,8,15(24),16,18,20,22-nonaene-3,10-dione (PubChem CID 74340057) has the molecular formula C27H22O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 13-butyl-12,25-dioxahexacyclo[11.11.1.02,11.04,9.015,24.016,21]pentacosa-2(11),4,6,8,15(24),16,18,20,22-nonaene-3,10-dione.
| Compound Name | 13-butyl-12,25-dioxahexacyclo[11.11.1.02,11.04,9.015,24.016,21]pentacosa-2(11),4,6,8,15(24),16,18,20,22-nonaene-3,10-dione |
|---|---|
| PubChem CID | 74340057 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 13-butyl-12,25-dioxahexacyclo[11.11.1.02,11.04,9.015,24.016,21]pentacosa-2(11),4,6,8,15(24),16,18,20,22-nonaene-3,10-dione |
| SMILES | CCCCC12Cc3c(ccc4ccccc34)C(O1)C1=C(O2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H22O4/c1-2-3-14-27-15-21-17-9-5-4-8-16(17)12-13-20(21)25(30-27)22-23(28)18-10-6-7-11-19(18)24(29)26(22)31-27/h4-13,25H,2-3,14-15H2,1H3 |
| InChIKey | RHQFOKAZXDDBGQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|