About N,N'-dihydroxyethanimidamide
N,N'-dihydroxyethanimidamide (PubChem CID 74340108) has the molecular formula C2H6N2O2
and a molecular weight of 90.08 g/mol. Its IUPAC name is N,N'-dihydroxyethanimidamide.
Molecular Properties
| Compound Name | N,N'-dihydroxyethanimidamide |
| PubChem CID | 74340108 |
| Molecular Formula | C2H6N2O2 |
| Molecular Weight | 90.08 g/mol |
| Exact Mass | 90.04 |
| IUPAC Name | N,N'-dihydroxyethanimidamide |
| SMILES | CC(=NO)NO |
| InChI | InChI=1S/C2H6N2O2/c1-2(3-5)4-6/h5-6H,1H3,(H,3,4) |
| InChIKey | CEMNRPYPLBVCAS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.08 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dihydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dihydroxyethanimidamide?
The IUPAC name of N,N'-dihydroxyethanimidamide (CID 74340108) is N,N'-dihydroxyethanimidamide.
What is the SMILES notation for N,N'-dihydroxyethanimidamide?
The canonical SMILES for N,N'-dihydroxyethanimidamide is CC(=NO)NO.
What is the InChIKey of N,N'-dihydroxyethanimidamide?
The InChIKey is CEMNRPYPLBVCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2/c1-2(3-5)4-6/h5-6H,1H3,(H,3,4).
What are the key properties of N,N'-dihydroxyethanimidamide?
N,N'-dihydroxyethanimidamide has a molecular weight of 90.08 g/mol, XLogP of -0.23, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dihydroxyethanimidamide is sourced from PubChem (CID 74340108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).