C20H29ClN2O — CID 74340123
2-(4-chlorophenyl)-N-[2-(piperidin-1-ylmethyl)cyclohexyl]acetamide (PubChem CID 74340123) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(piperidin-1-ylmethyl)cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(piperidin-1-ylmethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 74340123 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(piperidin-1-ylmethyl)cyclohexyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC1CCCCC1CN1CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O/c21-18-10-8-16(9-11-18)14-20(24)22-19-7-3-2-6-17(19)15-23-12-4-1-5-13-23/h8-11,17,19H,1-7,12-15H2,(H,22,24) |
| InChIKey | PUYIMUITNBOEBC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |