C26H21FN4O2S — CID 74341799
N-[1-(4-fluorophenyl)ethyl]-3-(2-isoquinolin-3-yl-1H-imidazol-5-yl)benzenesulfonamide (PubChem CID 74341799) has the molecular formula C26H21FN4O2S and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-3-(2-isoquinolin-3-yl-1H-imidazol-5-yl)benzenesulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-3-(2-isoquinolin-3-yl-1H-imidazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 74341799 |
| Molecular Formula | C26H21FN4O2S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-3-(2-isoquinolin-3-yl-1H-imidazol-5-yl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc(-c2cnc(-c3cc4ccccc4cn3)[nH]2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN4O2S/c1-17(18-9-11-22(27)12-10-18)31-34(32,33)23-8-4-7-20(13-23)25-16-29-26(30-25)24-14-19-5-2-3-6-21(19)15-28-24/h2-17,31H,1H3,(H,29,30) |
| InChIKey | DFNKSKCHBRQZRR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |