C24H21Cl2NO3 — CID 74343750
3,13-dichloro-17-cyclohexyl-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione (PubChem CID 74343750) has the molecular formula C24H21Cl2NO3 and a molecular weight of 442.34 g/mol. Its IUPAC name is 3,13-dichloro-17-cyclohexyl-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione.
| Compound Name | 3,13-dichloro-17-cyclohexyl-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 74343750 |
| Molecular Formula | C24H21Cl2NO3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3,13-dichloro-17-cyclohexyl-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
| SMILES | O=C1C2C3c4cccc(Cl)c4C(O)(c4c(Cl)cccc43)C2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C24H21Cl2NO3/c25-15-10-4-8-13-17-14-9-5-11-16(26)20(14)24(30,19(13)15)21-18(17)22(28)27(23(21)29)12-6-2-1-3-7-12/h4-5,8-12,17-18,21,30H,1-3,6-7H2 |
| InChIKey | YLIBCJWYFDNKQL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|