About N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide
N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide (PubChem CID 7434776) has the molecular formula C26H33N4O+
and a molecular weight of 417.58 g/mol. Its IUPAC name is N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide |
| PubChem CID | 7434776 |
| Molecular Formula | C26H33N4O+ |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc2cc(C#N)c(NCCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C |
| InChI | InChI=1S/C26H32N4O/c1-16-4-5-21-11-22(15-27)24(30-23(21)17(16)2)28-6-3-7-29-25(31)26-12-18-8-19(13-26)10-20(9-18)14-26/h4-5,11,18-20H,3,6-10,12-14H2,1-2H3,(H,28,30)(H,29,31)/p+1 |
| InChIKey | XDJJVYWPRZSLBZ-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide?
The IUPAC name of N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide (CID 7434776) is N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide?
The canonical SMILES for N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide is Cc1ccc2cc(C#N)c(NCCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C.
What is the InChIKey of N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide?
The InChIKey is XDJJVYWPRZSLBZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C26H32N4O/c1-16-4-5-21-11-22(15-27)24(30-23(21)17(16)2)28-6-3-7-29-25(31)26-12-18-8-19(13-26)10-20(9-18)14-26/h4-5,11,18-20H,3,6-10,12-14H2,1-2H3,(H,28,30)(H,29,31)/p+1.
What are the key properties of N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide?
N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide has a molecular weight of 417.58 g/mol, XLogP of 4.28, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]propyl]adamantane-1-carboxamide is sourced from PubChem (CID 7434776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).