C21H29NO4 — CID 74348698
14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-one (PubChem CID 74348698) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-one.
| Compound Name | 14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-one |
|---|---|
| PubChem CID | 74348698 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-one |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CCC2(C)C(=O)CCC24)C=C3C(O)C1O |
| InChI | InChI=1S/C21H29NO4/c1-19-7-6-12-10-13-17(24)18(25)14(22(2)3)11-20(13)8-9-21(12,26-20)15(19)4-5-16(19)23/h6,10,14-15,17-18,24-25H,4-5,7-9,11H2,1-3H3 |
| InChIKey | DSQHVNQZPJBRJK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |