C36H52N6O6S — CID 74348993
14-benzyl-5-[1-(2-methylbut-3-en-2-yloxy)ethyl]-2,17-di(propan-2-yl)-22-thia-3,6,12,15,18,23-hexazatricyclo[18.2.1.08,12]tricos-1(23)-ene-4,7,13,16,19-pentone (PubChem CID 74348993) has the molecular formula C36H52N6O6S and a molecular weight of 696.92 g/mol. Its IUPAC name is 14-benzyl-5-[1-(2-methylbut-3-en-2-yloxy)ethyl]-2,17-di(propan-2-yl)-22-thia-3,6,12,15,18,23-hexazatricyclo[18.2.1.08,12]tricos-1(23)-ene-4,7,13,16,19-pentone.
| Compound Name | 14-benzyl-5-[1-(2-methylbut-3-en-2-yloxy)ethyl]-2,17-di(propan-2-yl)-22-thia-3,6,12,15,18,23-hexazatricyclo[18.2.1.08,12]tricos-1(23)-ene-4,7,13,16,19-pentone |
|---|---|
| PubChem CID | 74348993 |
| Molecular Formula | C36H52N6O6S |
| Molecular Weight | 696.92 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | 14-benzyl-5-[1-(2-methylbut-3-en-2-yloxy)ethyl]-2,17-di(propan-2-yl)-22-thia-3,6,12,15,18,23-hexazatricyclo[18.2.1.08,12]tricos-1(23)-ene-4,7,13,16,19-pentone |
| SMILES | C=CC(C)(C)OC(C)C1NC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC(=O)C(C(C)C)NC(=O)C2CSC(=N2)C(C(C)C)NC1=O |
| InChI | InChI=1S/C36H52N6O6S/c1-9-36(7,8)48-22(6)29-33(46)40-28(21(4)5)34-38-25(19-49-34)30(43)39-27(20(2)3)32(45)37-24(18-23-14-11-10-12-15-23)35(47)42-17-13-16-26(42)31(44)41-29/h9-12,14-15,20-22,24-29H,1,13,16-19H2,2-8H3,(H,37,45)(H,39,43)(H,40,46)(H,41,44) |
| InChIKey | DXCFOKOBTQHBHK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.92 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|