About N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline
N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline (PubChem CID 743638) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline |
| PubChem CID | 743638 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline |
| SMILES | COc1cc(C)c(CNc2cc(C)cc(C)c2)cc1C |
| InChI | InChI=1S/C18H23NO/c1-12-6-13(2)8-17(7-12)19-11-16-9-15(4)18(20-5)10-14(16)3/h6-10,19H,11H2,1-5H3 |
| InChIKey | TUKMUJPXBCVRCZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline?
The IUPAC name of N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline (CID 743638) is N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline.
What is the SMILES notation for N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline?
The canonical SMILES for N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline is COc1cc(C)c(CNc2cc(C)cc(C)c2)cc1C.
What is the InChIKey of N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline?
The InChIKey is TUKMUJPXBCVRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-12-6-13(2)8-17(7-12)19-11-16-9-15(4)18(20-5)10-14(16)3/h6-10,19H,11H2,1-5H3.
What are the key properties of N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline?
N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline has a molecular weight of 269.39 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methoxy-2,5-dimethylphenyl)methyl]-3,5-dimethylaniline is sourced from PubChem (CID 743638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).