About benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone
benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone (PubChem CID 743706) has the molecular formula C15H13N3O3
and a molecular weight of 283.29 g/mol. Its IUPAC name is benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone |
| PubChem CID | 743706 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)n2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C15H13N3O3/c1-20-13-8-7-10(9-14(13)21-2)15(19)18-12-6-4-3-5-11(12)16-17-18/h3-9H,1-2H3 |
| InChIKey | GCEWJBIDLIIRAB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone?
The IUPAC name of benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone (CID 743706) is benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone.
What is the SMILES notation for benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone?
The canonical SMILES for benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone is COc1ccc(C(=O)n2nnc3ccccc32)cc1OC.
What is the InChIKey of benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone?
The InChIKey is GCEWJBIDLIIRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O3/c1-20-13-8-7-10(9-14(13)21-2)15(19)18-12-6-4-3-5-11(12)16-17-18/h3-9H,1-2H3.
What are the key properties of benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone?
benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone has a molecular weight of 283.29 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl-(3,4-dimethoxyphenyl)methanone is sourced from PubChem (CID 743706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).