C12H20O4 — CID 74371640
10-hydroxy-12-methyl-oxacyclododecane-2,5-dione (PubChem CID 74371640) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 10-hydroxy-12-methyl-oxacyclododecane-2,5-dione.
| Compound Name | 10-hydroxy-12-methyl-oxacyclododecane-2,5-dione |
|---|---|
| PubChem CID | 74371640 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 10-hydroxy-12-methyl-oxacyclododecane-2,5-dione |
| SMILES | CC1CC(O)CCCCC(=O)CCC(=O)O1 |
| InChI | InChI=1S/C12H20O4/c1-9-8-11(14)5-3-2-4-10(13)6-7-12(15)16-9/h9,11,14H,2-8H2,1H3 |
| InChIKey | SJESPTPLVNJOCS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |