C22H32N4O3 — CID 74371730
3-[2-tert-butyl-3-[[ethyl(oxolan-3-ylmethyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 74371730) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-[2-tert-butyl-3-[[ethyl(oxolan-3-ylmethyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[2-tert-butyl-3-[[ethyl(oxolan-3-ylmethyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74371730 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-[2-tert-butyl-3-[[ethyl(oxolan-3-ylmethyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCN(Cc1c(C(C)(C)C)nc2cc(C=CC(=O)NO)ccn12)CC1CCOC1 |
| InChI | InChI=1S/C22H32N4O3/c1-5-25(13-17-9-11-29-15-17)14-18-21(22(2,3)4)23-19-12-16(8-10-26(18)19)6-7-20(27)24-28/h6-8,10,12,17,28H,5,9,11,13-15H2,1-4H3,(H,24,27) |
| InChIKey | SOZUZPITYVRXEX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|