C15H31N3O3+2 — CID 7437314
2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]azaniumyl]ethyl-diethylazanium (PubChem CID 7437314) has the molecular formula C15H31N3O3+2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]azaniumyl]ethyl-diethylazanium.
| Compound Name | 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]azaniumyl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7437314 |
| Molecular Formula | C15H31N3O3+2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]azaniumyl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC[NH2+]CC(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H29N3O3/c1-3-17(4-2)10-7-16-13-14(19)18-8-5-15(6-9-18)20-11-12-21-15/h16H,3-13H2,1-2H3/p+2 |
| InChIKey | RUJWFMYDGATJKG-UHFFFAOYSA-P |
| XLogP | -2.16 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|