C23H30N3OS+ — CID 7437560
4-benzyl-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 7437560) has the molecular formula C23H30N3OS+ and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-benzyl-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 7437560 |
| Molecular Formula | C23H30N3OS+ |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-benzyl-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CC1CC[NH+](CCCNC(=O)c2cc3sccc3n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3OS/c1-18-8-13-25(14-9-18)12-5-11-24-23(27)21-16-22-20(10-15-28-22)26(21)17-19-6-3-2-4-7-19/h2-4,6-7,10,15-16,18H,5,8-9,11-14,17H2,1H3,(H,24,27)/p+1 |
| InChIKey | DICHVJSSWOMONE-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 38.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|