C27H42O6 — CID 74379743
2,3-dihydroxy-10,14-dimethyl-17-(2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,11,15,16,17-decahydrocyclopenta[a]phenanthren-6-one (PubChem CID 74379743) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2,3-dihydroxy-10,14-dimethyl-17-(2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,11,15,16,17-decahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | 2,3-dihydroxy-10,14-dimethyl-17-(2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,11,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 74379743 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 2,3-dihydroxy-10,14-dimethyl-17-(2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,11,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)(O)CCC(O)C(C)(O)C1CCC2(C)C1=CCC1C2=CC(=O)C2CC(O)C(O)CC21C |
| InChI | InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)17-8-11-25(3)15(17)6-7-16-18(25)12-20(28)19-13-21(29)22(30)14-26(16,19)4/h6,12,16-17,19,21-23,29-33H,7-11,13-14H2,1-5H3 |
| InChIKey | DSUMGVHMUUADBM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|