C17H13F5O2 — CID 74380181
5-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2-propylbenzene-1,3-diol (PubChem CID 74380181) has the molecular formula C17H13F5O2 and a molecular weight of 344.28 g/mol. Its IUPAC name is 5-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2-propylbenzene-1,3-diol.
| Compound Name | 5-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 74380181 |
| Molecular Formula | C17H13F5O2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2-propylbenzene-1,3-diol |
| SMILES | CCCc1c(O)cc(C=Cc2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C17H13F5O2/c1-2-3-9-11(23)6-8(7-12(9)24)4-5-10-13(18)15(20)17(22)16(21)14(10)19/h4-7,23-24H,2-3H2,1H3 |
| InChIKey | OMWQVOTXENZRIH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|