C18H21ClN4O3S — CID 7438249
(3R)-1-(3-chloro-4-methylphenyl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 7438249) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methylphenyl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-methylphenyl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7438249 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (3R)-1-(3-chloro-4-methylphenyl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOCCc1nnc(NC(=O)[C@@H]2CC(=O)N(c3ccc(C)c(Cl)c3)C2)s1 |
| InChI | InChI=1S/C18H21ClN4O3S/c1-3-26-7-6-15-21-22-18(27-15)20-17(25)12-8-16(24)23(10-12)13-5-4-11(2)14(19)9-13/h4-5,9,12H,3,6-8,10H2,1-2H3,(H,20,22,25)/t12-/m1/s1 |
| InChIKey | XLMWJTYSMWBPSZ-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|