About 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile
2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile (PubChem CID 74383124) has the molecular formula C8H4Cl2N2O
and a molecular weight of 215.04 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile |
| PubChem CID | 74383124 |
| Molecular Formula | C8H4Cl2N2O |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile |
| SMILES | N#CC(=NO)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H4Cl2N2O/c9-5-2-1-3-6(10)8(5)7(4-11)12-13/h1-3,13H |
| InChIKey | VVSVQEUICQEWCA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile?
The IUPAC name of 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile (CID 74383124) is 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile?
The canonical SMILES for 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile is N#CC(=NO)c1c(Cl)cccc1Cl.
What is the InChIKey of 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile?
The InChIKey is VVSVQEUICQEWCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O/c9-5-2-1-3-6(10)8(5)7(4-11)12-13/h1-3,13H.
What are the key properties of 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile?
2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile has a molecular weight of 215.04 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-2-hydroxyiminoacetonitrile is sourced from PubChem (CID 74383124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).