About (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate
(4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7438553) has the molecular formula C20H23NO6S
and a molecular weight of 405.47 g/mol. Its IUPAC name is (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 7438553 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(C)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H23NO6S/c1-15-3-5-16(6-4-15)14-27-20(22)17-7-8-18(25-2)19(13-17)28(23,24)21-9-11-26-12-10-21/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | ZEVXHDWWIZYEKT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate (CID 7438553) is (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate is COc1ccc(C(=O)OCc2ccc(C)cc2)cc1S(=O)(=O)N1CCOCC1.
What is the InChIKey of (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate?
The InChIKey is ZEVXHDWWIZYEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO6S/c1-15-3-5-16(6-4-15)14-27-20(22)17-7-8-18(25-2)19(13-17)28(23,24)21-9-11-26-12-10-21/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate?
(4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate has a molecular weight of 405.47 g/mol, XLogP of 2.38, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 7438553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).