C30H42N3O5S+ — CID 74386003
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[[4-(dimethylsulfamoyl)phenyl]methoxy]ethyl]-dimethylazanium (PubChem CID 74386003) has the molecular formula C30H42N3O5S+ and a molecular weight of 556.75 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[[4-(dimethylsulfamoyl)phenyl]methoxy]ethyl]-dimethylazanium.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[[4-(dimethylsulfamoyl)phenyl]methoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 74386003 |
| Molecular Formula | C30H42N3O5S+ |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[[4-(dimethylsulfamoyl)phenyl]methoxy]ethyl]-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1ccc(COCC[N+](C)(C)Cc2cnc(C(O)(c3ccccc3)C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C30H42N3O5S/c1-32(2)39(35,36)28-17-15-24(16-18-28)23-37-20-19-33(3,4)22-27-21-31-29(38-27)30(34,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5,7-8,11-12,15-18,21,26,34H,6,9-10,13-14,19-20,22-23H2,1-4H3/q+1 |
| InChIKey | QXZLFDNNFWWAMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|