C26H40O4 — CID 74386989
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl icosa-5,8,11,14,17-pentaenoate (PubChem CID 74386989) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl icosa-5,8,11,14,17-pentaenoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 74386989 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C26H40O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(27)28-22-24-23-29-26(2,3)30-24/h5-6,8-9,11-12,14-15,17-18,24H,4,7,10,13,16,19-23H2,1-3H3 |
| InChIKey | FFCZDVYDFIHRTN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|