About 1,5,6-trihydroxyhexa-3,5-dien-2-one
1,5,6-trihydroxyhexa-3,5-dien-2-one (PubChem CID 74388867) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 1,5,6-trihydroxyhexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | 1,5,6-trihydroxyhexa-3,5-dien-2-one |
| PubChem CID | 74388867 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 1,5,6-trihydroxyhexa-3,5-dien-2-one |
| SMILES | O=C(C=CC(O)=CO)CO |
| InChI | InChI=1S/C6H8O4/c7-3-5(9)1-2-6(10)4-8/h1-3,7-9H,4H2 |
| InChIKey | NZGYMRDDCOOVFX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,5,6-trihydroxyhexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,6-trihydroxyhexa-3,5-dien-2-one?
The IUPAC name of 1,5,6-trihydroxyhexa-3,5-dien-2-one (CID 74388867) is 1,5,6-trihydroxyhexa-3,5-dien-2-one.
What is the SMILES notation for 1,5,6-trihydroxyhexa-3,5-dien-2-one?
The canonical SMILES for 1,5,6-trihydroxyhexa-3,5-dien-2-one is O=C(C=CC(O)=CO)CO.
What is the InChIKey of 1,5,6-trihydroxyhexa-3,5-dien-2-one?
The InChIKey is NZGYMRDDCOOVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c7-3-5(9)1-2-6(10)4-8/h1-3,7-9H,4H2.
What are the key properties of 1,5,6-trihydroxyhexa-3,5-dien-2-one?
1,5,6-trihydroxyhexa-3,5-dien-2-one has a molecular weight of 144.13 g/mol, XLogP of 0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,6-trihydroxyhexa-3,5-dien-2-one is sourced from PubChem (CID 74388867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).