C11H12N2O2S2 — CID 743902
ethyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 743902) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is ethyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 743902 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | ethyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-2-15-10(14)6-16-11-13-8-4-3-7(12)5-9(8)17-11/h3-5H,2,6,12H2,1H3 |
| InChIKey | UTKWGIMCGGXPMY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|