C24H24N3O4+ — CID 7439339
N-(2-methoxy-5-nitrophenyl)-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide (PubChem CID 7439339) has the molecular formula C24H24N3O4+ and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 7439339 |
| Molecular Formula | C24H24N3O4+ |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1ccc(C[NH+]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-31-23-11-10-21(27(29)30)14-22(23)25-24(28)19-8-6-17(7-9-19)15-26-13-12-18-4-2-3-5-20(18)16-26/h2-11,14H,12-13,15-16H2,1H3,(H,25,28)/p+1 |
| InChIKey | PYJOMZMPXAGQDR-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|