About N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide
N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 743957) has the molecular formula C16H15N3O6
and a molecular weight of 345.31 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide.
Molecular Properties
| Compound Name | N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide |
| PubChem CID | 743957 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(N)=O)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H15N3O6/c1-24-13-7-11(12(19(22)23)8-14(13)25-2)16(21)18-10-5-3-9(4-6-10)15(17)20/h3-8H,1-2H3,(H2,17,20)(H,18,21) |
| InChIKey | BULPARYMZQDASZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide?
The IUPAC name of N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide (CID 743957) is N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide.
What is the SMILES notation for N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide?
The canonical SMILES for N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide is COc1cc(C(=O)Nc2ccc(C(N)=O)cc2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide?
The InChIKey is BULPARYMZQDASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O6/c1-24-13-7-11(12(19(22)23)8-14(13)25-2)16(21)18-10-5-3-9(4-6-10)15(17)20/h3-8H,1-2H3,(H2,17,20)(H,18,21).
What are the key properties of N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide?
N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide has a molecular weight of 345.31 g/mol, XLogP of 1.96, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-carbamoylphenyl)-4,5-dimethoxy-2-nitrobenzamide is sourced from PubChem (CID 743957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).