C12H18O4 — CID 74399174
6-hydroxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione (PubChem CID 74399174) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 6-hydroxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione.
| Compound Name | 6-hydroxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
|---|---|
| PubChem CID | 74399174 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 6-hydroxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
| SMILES | CC1CCCCCC(O)C(=O)C=CC(=O)O1 |
| InChI | InChI=1S/C12H18O4/c1-9-5-3-2-4-6-10(13)11(14)7-8-12(15)16-9/h7-10,13H,2-6H2,1H3 |
| InChIKey | OFRQIORIBGXHBF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |