About 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile
3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile (PubChem CID 74400387) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile |
| PubChem CID | 74400387 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1ccc2c(n1)C=CC1OC21 |
| InChI | InChI=1S/C12H8N2O/c13-7-1-2-8-3-4-9-10(14-8)5-6-11-12(9)15-11/h1-6,11-12H |
| InChIKey | JTDDXZNLYDYGBJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile?
The IUPAC name of 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile (CID 74400387) is 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile.
What is the SMILES notation for 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile?
The canonical SMILES for 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile is N#CC=Cc1ccc2c(n1)C=CC1OC21.
What is the InChIKey of 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile?
The InChIKey is JTDDXZNLYDYGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c13-7-1-2-8-3-4-9-10(14-8)5-6-11-12(9)15-11/h1-6,11-12H.
What are the key properties of 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile?
3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile has a molecular weight of 196.21 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1a,7b-dihydrooxireno[2,3-f]quinolin-5-yl)prop-2-enenitrile is sourced from PubChem (CID 74400387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).