C24H22FN5O3 — CID 74401895
1-[1-(4-fluorophenyl)ethyl]-6-imino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3-diazinane-2,4-dione (PubChem CID 74401895) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-6-imino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-6-imino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 74401895 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-6-imino-5-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\C(=Cc2ccc(-n3cnc(C)c3)c(OC)c2)C(=O)NC(=O)N1C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN5O3/c1-14-12-29(13-27-14)20-9-4-16(11-21(20)33-3)10-19-22(26)30(24(32)28-23(19)31)15(2)17-5-7-18(25)8-6-17/h4-13,15,26H,1-3H3,(H,28,31,32)/b19-10?,26-22+ |
| InChIKey | WZUQMQJGROLPOX-LGFRAFAISA-N |
| XLogP | 4.00 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|