C22H19N3O5 — CID 7440210
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 7440210) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 7440210 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | C[C@@H](OC(=O)c1c2c(nc3ccccc13)CCC2)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O5/c1-13(21(26)24-18-10-4-5-12-19(18)25(28)29)30-22(27)20-14-7-2-3-9-16(14)23-17-11-6-8-15(17)20/h2-5,7,9-10,12-13H,6,8,11H2,1H3,(H,24,26)/t13-/m1/s1 |
| InChIKey | SEPATSNGIKOQCB-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|