About 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea
1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea (PubChem CID 7440249) has the molecular formula C11H17N3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea.
Molecular Properties
| Compound Name | 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea |
| PubChem CID | 7440249 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N/N=C1/C[C@@H]2CC=C[C@H]12 |
| InChI | InChI=1S/C11H17N3S/c1-7(2)12-11(15)14-13-10-6-8-4-3-5-9(8)10/h3,5,7-9H,4,6H2,1-2H3,(H2,12,14,15)/b13-10-/t8-,9-/m0/s1 |
| InChIKey | BMVHKVHNVGCXRH-GSHHHWRASA-N |
| XLogP | 1.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea?
The IUPAC name of 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea (CID 7440249) is 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea.
What is the SMILES notation for 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea?
The canonical SMILES for 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea is CC(C)NC(=S)N/N=C1/C[C@@H]2CC=C[C@H]12.
What is the InChIKey of 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea?
The InChIKey is BMVHKVHNVGCXRH-GSHHHWRASA-N. The full InChI is InChI=1S/C11H17N3S/c1-7(2)12-11(15)14-13-10-6-8-4-3-5-9(8)10/h3,5,7-9H,4,6H2,1-2H3,(H2,12,14,15)/b13-10-/t8-,9-/m0/s1.
What are the key properties of 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea?
1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea has a molecular weight of 223.34 g/mol, XLogP of 1.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-propan-2-ylthiourea is sourced from PubChem (CID 7440249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).