About 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide (PubChem CID 744025) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide |
| PubChem CID | 744025 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C14H19N3OS/c1-5-17(6-2)13(18)9-19-14-12(8-15)10(3)7-11(4)16-14/h7H,5-6,9H2,1-4H3 |
| InChIKey | PKPCZCWPPKZETC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide?
The IUPAC name of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide (CID 744025) is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide.
What is the SMILES notation for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide?
The canonical SMILES for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide is CCN(CC)C(=O)CSc1nc(C)cc(C)c1C#N.
What is the InChIKey of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide?
The InChIKey is PKPCZCWPPKZETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c1-5-17(6-2)13(18)9-19-14-12(8-15)10(3)7-11(4)16-14/h7H,5-6,9H2,1-4H3.
What are the key properties of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide?
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide has a molecular weight of 277.39 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N,N-diethylacetamide is sourced from PubChem (CID 744025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).