C18H26N8O2 — CID 74402505
N'-cyano-N,N-bis(2-hydroxyethyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide (PubChem CID 74402505) has the molecular formula C18H26N8O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N'-cyano-N,N-bis(2-hydroxyethyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide.
| Compound Name | N'-cyano-N,N-bis(2-hydroxyethyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 74402505 |
| Molecular Formula | C18H26N8O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N'-cyano-N,N-bis(2-hydroxyethyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/C#N)N(CCO)CCO)C(C)C3)c12 |
| InChI | InChI=1S/C18H26N8O2/c1-13-9-20-16-15(13)17(23-12-22-16)25-3-4-26(14(2)10-25)18(21-11-19)24(5-7-27)6-8-28/h9,12,14,27-28H,3-8,10H2,1-2H3,(H,20,22,23)/b21-18+ |
| InChIKey | ZZTUUTCBKPHYEE-DYTRJAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|