C11H17NO2 — CID 74405774
N-(2-methylpropyl)-6-oxohepta-2,4-dienamide (PubChem CID 74405774) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-(2-methylpropyl)-6-oxohepta-2,4-dienamide.
| Compound Name | N-(2-methylpropyl)-6-oxohepta-2,4-dienamide |
|---|---|
| PubChem CID | 74405774 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-(2-methylpropyl)-6-oxohepta-2,4-dienamide |
| SMILES | CC(=O)C=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C11H17NO2/c1-9(2)8-12-11(14)7-5-4-6-10(3)13/h4-7,9H,8H2,1-3H3,(H,12,14) |
| InChIKey | WOZPVGYGEASHHK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|