C15H21NO3Te — CID 74407382
methyl 3-methyl-2-(3-phenyltellanylpropanoylamino)butanoate (PubChem CID 74407382) has the molecular formula C15H21NO3Te and a molecular weight of 390.94 g/mol. Its IUPAC name is methyl 3-methyl-2-(3-phenyltellanylpropanoylamino)butanoate.
| Compound Name | methyl 3-methyl-2-(3-phenyltellanylpropanoylamino)butanoate |
|---|---|
| PubChem CID | 74407382 |
| Molecular Formula | C15H21NO3Te |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl 3-methyl-2-(3-phenyltellanylpropanoylamino)butanoate |
| SMILES | COC(=O)C(NC(=O)CC[Te]c1ccccc1)C(C)C |
| InChI | InChI=1S/C15H21NO3Te/c1-11(2)14(15(18)19-3)16-13(17)9-10-20-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3,(H,16,17) |
| InChIKey | RYZJAALKCCSUFU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|