C16H23NO3Te — CID 74407383
methyl 3-methyl-2-(4-phenyltellanylbutanoylamino)butanoate (PubChem CID 74407383) has the molecular formula C16H23NO3Te and a molecular weight of 404.96 g/mol. Its IUPAC name is methyl 3-methyl-2-(4-phenyltellanylbutanoylamino)butanoate.
| Compound Name | methyl 3-methyl-2-(4-phenyltellanylbutanoylamino)butanoate |
|---|---|
| PubChem CID | 74407383 |
| Molecular Formula | C16H23NO3Te |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | methyl 3-methyl-2-(4-phenyltellanylbutanoylamino)butanoate |
| SMILES | COC(=O)C(NC(=O)CCC[Te]c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H23NO3Te/c1-12(2)15(16(19)20-3)17-14(18)10-7-11-21-13-8-5-4-6-9-13/h4-6,8-9,12,15H,7,10-11H2,1-3H3,(H,17,18) |
| InChIKey | GDFAIBKQFSSPAS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|