C21H16Cl2F3N3O2 — CID 74409405
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N'-prop-2-ynoxybenzenecarboximidamide (PubChem CID 74409405) has the molecular formula C21H16Cl2F3N3O2 and a molecular weight of 470.28 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N'-prop-2-ynoxybenzenecarboximidamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N'-prop-2-ynoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 74409405 |
| Molecular Formula | C21H16Cl2F3N3O2 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N'-prop-2-ynoxybenzenecarboximidamide |
| SMILES | C#CCON=C(N)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C21H16Cl2F3N3O2/c1-3-6-30-29-19(27)17-5-4-13(7-12(17)2)18-11-20(31-28-18,21(24,25)26)14-8-15(22)10-16(23)9-14/h1,4-5,7-10H,6,11H2,2H3,(H2,27,29) |
| InChIKey | GXDPELZAWVFRAQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|