About [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea
[1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea (PubChem CID 74411426) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea.
Molecular Properties
| Compound Name | [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea |
| PubChem CID | 74411426 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)C1=CCCc2ccccc21 |
| InChI | InChI=1S/C13H15N3S/c1-9(15-16-13(14)17)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7-8H,4,6H2,1H3,(H3,14,16,17) |
| InChIKey | TUDYTKGUDDASOW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea?
The IUPAC name of [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea (CID 74411426) is [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea.
What is the SMILES notation for [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea?
The canonical SMILES for [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea is CC(=NNC(N)=S)C1=CCCc2ccccc21.
What is the InChIKey of [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea?
The InChIKey is TUDYTKGUDDASOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S/c1-9(15-16-13(14)17)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7-8H,4,6H2,1H3,(H3,14,16,17).
What are the key properties of [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea?
[1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea has a molecular weight of 245.35 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dihydronaphthalen-1-yl)ethylideneamino]thiourea is sourced from PubChem (CID 74411426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).